C24H28N2O2 — CID 123249536
(5aR,9aS)-2,9a-dimethyl-7-oxo-3-phenylspiro[5,5a,8,9-tetrahydro-4H-benzo[g]indazole-6,1'-cyclopentane]-8-carbaldehyde (PubChem CID 123249536) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is (5aR,9aS)-2,9a-dimethyl-7-oxo-3-phenylspiro[5,5a,8,9-tetrahydro-4H-benzo[g]indazole-6,1'-cyclopentane]-8-carbaldehyde.
| Compound Name | (5aR,9aS)-2,9a-dimethyl-7-oxo-3-phenylspiro[5,5a,8,9-tetrahydro-4H-benzo[g]indazole-6,1'-cyclopentane]-8-carbaldehyde |
|---|---|
| PubChem CID | 123249536 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | (5aR,9aS)-2,9a-dimethyl-7-oxo-3-phenylspiro[5,5a,8,9-tetrahydro-4H-benzo[g]indazole-6,1'-cyclopentane]-8-carbaldehyde |
| SMILES | Cn1nc2c(c1-c1ccccc1)CC[C@H]1C3(CCCC3)C(=O)C(C=O)C[C@]21C |
| InChI | InChI=1S/C24H28N2O2/c1-23-14-17(15-27)22(28)24(12-6-7-13-24)19(23)11-10-18-20(26(2)25-21(18)23)16-8-4-3-5-9-16/h3-5,8-9,15,17,19H,6-7,10-14H2,1-2H3/t17?,19-,23+/m1/s1 |
| InChIKey | JGRGKJOPOQJPNU-PNYWAOBFSA-N |
| XLogP | 4.26 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|