C22H23N3O2 — CID 164939419
(1S,9R,12R,14S)-1,4,10,10-tetramethyl-11-oxo-5-phenyl-13-oxa-3,4-diazatetracyclo[7.5.0.02,6.012,14]tetradeca-2,5-diene-12-carbonitrile (PubChem CID 164939419) has the molecular formula C22H23N3O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is (1S,9R,12R,14S)-1,4,10,10-tetramethyl-11-oxo-5-phenyl-13-oxa-3,4-diazatetracyclo[7.5.0.02,6.012,14]tetradeca-2,5-diene-12-carbonitrile.
| Compound Name | (1S,9R,12R,14S)-1,4,10,10-tetramethyl-11-oxo-5-phenyl-13-oxa-3,4-diazatetracyclo[7.5.0.02,6.012,14]tetradeca-2,5-diene-12-carbonitrile |
|---|---|
| PubChem CID | 164939419 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | (1S,9R,12R,14S)-1,4,10,10-tetramethyl-11-oxo-5-phenyl-13-oxa-3,4-diazatetracyclo[7.5.0.02,6.012,14]tetradeca-2,5-diene-12-carbonitrile |
| SMILES | Cn1nc2c(c1-c1ccccc1)CC[C@H]1C(C)(C)C(=O)[C@]3(C#N)O[C@H]3[C@]21C |
| InChI | InChI=1S/C22H23N3O2/c1-20(2)15-11-10-14-16(13-8-6-5-7-9-13)25(4)24-17(14)21(15,3)19-22(12-23,27-19)18(20)26/h5-9,15,19H,10-11H2,1-4H3/t15-,19-,21-,22-/m0/s1 |
| InChIKey | IHJWHVQSVAQGKX-KXYFNNKZSA-N |
| XLogP | 3.18 |
| TPSA | 71.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|