C31H27FN4O2 — CID 135131719
(1R,10S,13S,15S)-6-[(3Z)-2-fluorohexa-1,3,5-trien-3-yl]-1,11,11-trimethyl-12-oxo-4-quinolin-4-yl-14-oxa-3,5-diazatetracyclo[8.5.0.02,7.013,15]pentadeca-2,4,6-triene-13-carbonitrile (PubChem CID 135131719) has the molecular formula C31H27FN4O2 and a molecular weight of 506.58 g/mol. Its IUPAC name is (1R,10S,13S,15S)-6-[(3Z)-2-fluorohexa-1,3,5-trien-3-yl]-1,11,11-trimethyl-12-oxo-4-quinolin-4-yl-14-oxa-3,5-diazatetracyclo[8.5.0.02,7.013,15]pentadeca-2,4,6-triene-13-carbonitrile.
| Compound Name | (1R,10S,13S,15S)-6-[(3Z)-2-fluorohexa-1,3,5-trien-3-yl]-1,11,11-trimethyl-12-oxo-4-quinolin-4-yl-14-oxa-3,5-diazatetracyclo[8.5.0.02,7.013,15]pentadeca-2,4,6-triene-13-carbonitrile |
|---|---|
| PubChem CID | 135131719 |
| Molecular Formula | C31H27FN4O2 |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | (1R,10S,13S,15S)-6-[(3Z)-2-fluorohexa-1,3,5-trien-3-yl]-1,11,11-trimethyl-12-oxo-4-quinolin-4-yl-14-oxa-3,5-diazatetracyclo[8.5.0.02,7.013,15]pentadeca-2,4,6-triene-13-carbonitrile |
| SMILES | C=C/C=C(\C(=C)F)c1nc(-c2ccnc3ccccc23)nc2c1CC[C@@H]1C(C)(C)C(=O)[C@@]3(C#N)O[C@H]3[C@@]21C |
| InChI | InChI=1S/C31H27FN4O2/c1-6-9-18(17(2)32)24-21-12-13-23-29(3,4)27(37)31(16-33)28(38-31)30(23,5)25(21)36-26(35-24)20-14-15-34-22-11-8-7-10-19(20)22/h6-11,14-15,23,28H,1-2,12-13H2,3-5H3/b18-9+/t23-,28+,30-,31-/m1/s1 |
| InChIKey | OIQJBWNPRKXAPQ-KAZNHQCKSA-N |
| XLogP | 5.83 |
| TPSA | 92.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|