C36H31BF2N2O4 — CID 57385981
diethyl 2,2-difluoro-4-methyl-6,10-diphenyl-12-[(E)-2-phenylethenyl]-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene-5,11-dicarboxylate (PubChem CID 57385981) has the molecular formula C36H31BF2N2O4 and a molecular weight of 604.46 g/mol. Its IUPAC name is diethyl 2,2-difluoro-4-methyl-6,10-diphenyl-12-[(E)-2-phenylethenyl]-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene-5,11-dicarboxylate.
| Compound Name | diethyl 2,2-difluoro-4-methyl-6,10-diphenyl-12-[(E)-2-phenylethenyl]-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene-5,11-dicarboxylate |
|---|---|
| PubChem CID | 57385981 |
| Molecular Formula | C36H31BF2N2O4 |
| Molecular Weight | 604.46 g/mol |
| Exact Mass | 604.23 |
| IUPAC Name | diethyl 2,2-difluoro-4-methyl-6,10-diphenyl-12-[(E)-2-phenylethenyl]-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene-5,11-dicarboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)C2=Cc3c(-c4ccccc4)c(C(=O)OCC)c(C)n3[B-](F)(F)[N+]2=C1/C=C/c1ccccc1 |
| InChI | InChI=1S/C36H31BF2N2O4/c1-4-44-35(42)31-24(3)40-29(32(31)26-17-11-7-12-18-26)23-30-33(27-19-13-8-14-20-27)34(36(43)45-5-2)28(41(30)37(40,38)39)22-21-25-15-9-6-10-16-25/h6-23H,4-5H2,1-3H3/b22-21+ |
| InChIKey | GYKXHRJVUMZSKZ-QURGRASLSA-N |
| XLogP | 7.41 |
| TPSA | 60.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.46 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|