C29H30FIN4O5S — CID 57388518
N-[3-[3-cyclopropyl-5-(2-fluoro-4-iodoanilino)-6,8-dimethyl-2,4,7-trioxo-1,6-naphthyridin-1-yl]phenyl]acetamide;methylsulfinylmethane (PubChem CID 57388518) has the molecular formula C29H30FIN4O5S and a molecular weight of 692.55 g/mol. Its IUPAC name is N-[3-[3-cyclopropyl-5-(2-fluoro-4-iodoanilino)-6,8-dimethyl-2,4,7-trioxo-1,6-naphthyridin-1-yl]phenyl]acetamide;methylsulfinylmethane.
| Compound Name | N-[3-[3-cyclopropyl-5-(2-fluoro-4-iodoanilino)-6,8-dimethyl-2,4,7-trioxo-1,6-naphthyridin-1-yl]phenyl]acetamide;methylsulfinylmethane |
|---|---|
| PubChem CID | 57388518 |
| Molecular Formula | C29H30FIN4O5S |
| Molecular Weight | 692.55 g/mol |
| Exact Mass | 692.10 |
| IUPAC Name | N-[3-[3-cyclopropyl-5-(2-fluoro-4-iodoanilino)-6,8-dimethyl-2,4,7-trioxo-1,6-naphthyridin-1-yl]phenyl]acetamide;methylsulfinylmethane |
| SMILES | CC(=O)Nc1cccc(N2C(=O)C(C3CC3)C(=O)c3c2c(C)c(=O)n(C)c3Nc2ccc(I)cc2F)c1.CS(C)=O |
| InChI | InChI=1S/C27H24FIN4O4.C2H6OS/c1-13-23-22(25(32(3)26(13)36)31-20-10-9-16(29)11-19(20)28)24(35)21(15-7-8-15)27(37)33(23)18-6-4-5-17(12-18)30-14(2)34;1-4(2)3/h4-6,9-12,15,21,31H,7-8H2,1-3H3,(H,30,34);1-2H3 |
| InChIKey | WQMDHXYLNWZSAF-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|