C30H27N3O3 — CID 57399914
N-[(3-cyanophenyl)methyl]-4-[4-[2-[(3S)-3-hydroxy-1-azabicyclo[2.2.2]octan-3-yl]ethynyl]phenoxy]benzamide (PubChem CID 57399914) has the molecular formula C30H27N3O3 and a molecular weight of 477.56 g/mol. Its IUPAC name is N-[(3-cyanophenyl)methyl]-4-[4-[2-[(3S)-3-hydroxy-1-azabicyclo[2.2.2]octan-3-yl]ethynyl]phenoxy]benzamide.
| Compound Name | N-[(3-cyanophenyl)methyl]-4-[4-[2-[(3S)-3-hydroxy-1-azabicyclo[2.2.2]octan-3-yl]ethynyl]phenoxy]benzamide |
|---|---|
| PubChem CID | 57399914 |
| Molecular Formula | C30H27N3O3 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | N-[(3-cyanophenyl)methyl]-4-[4-[2-[(3S)-3-hydroxy-1-azabicyclo[2.2.2]octan-3-yl]ethynyl]phenoxy]benzamide |
| SMILES | N#Cc1cccc(CNC(=O)c2ccc(Oc3ccc(C#C[C@]4(O)CN5CCC4CC5)cc3)cc2)c1 |
| InChI | InChI=1S/C30H27N3O3/c31-19-23-2-1-3-24(18-23)20-32-29(34)25-6-10-28(11-7-25)36-27-8-4-22(5-9-27)12-15-30(35)21-33-16-13-26(30)14-17-33/h1-11,18,26,35H,13-14,16-17,20-21H2,(H,32,34)/t30-/m0/s1 |
| InChIKey | BJMJYODXDWMFDH-PMERELPUSA-N |
| XLogP | 4.09 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|