C31H32N2O5 — CID 57403420
N-[(3,4-dimethoxyphenyl)methyl]-4-[4-[2-[(3S)-3-hydroxy-1-azabicyclo[2.2.2]octan-3-yl]ethynyl]phenoxy]benzamide (PubChem CID 57403420) has the molecular formula C31H32N2O5 and a molecular weight of 512.61 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-4-[4-[2-[(3S)-3-hydroxy-1-azabicyclo[2.2.2]octan-3-yl]ethynyl]phenoxy]benzamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-4-[4-[2-[(3S)-3-hydroxy-1-azabicyclo[2.2.2]octan-3-yl]ethynyl]phenoxy]benzamide |
|---|---|
| PubChem CID | 57403420 |
| Molecular Formula | C31H32N2O5 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-4-[4-[2-[(3S)-3-hydroxy-1-azabicyclo[2.2.2]octan-3-yl]ethynyl]phenoxy]benzamide |
| SMILES | COc1ccc(CNC(=O)c2ccc(Oc3ccc(C#C[C@]4(O)CN5CCC4CC5)cc3)cc2)cc1OC |
| InChI | InChI=1S/C31H32N2O5/c1-36-28-12-5-23(19-29(28)37-2)20-32-30(34)24-6-10-27(11-7-24)38-26-8-3-22(4-9-26)13-16-31(35)21-33-17-14-25(31)15-18-33/h3-12,19,25,35H,14-15,17-18,20-21H2,1-2H3,(H,32,34)/t31-/m0/s1 |
| InChIKey | BDWCIDSXORGMEX-HKBQPEDESA-N |
| XLogP | 4.23 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|