C16H18O5 — CID 57400515
6-[2-(3,4-dimethoxyphenyl)ethyl]-4-methoxypyran-2-one (PubChem CID 57400515) has the molecular formula C16H18O5 and a molecular weight of 290.32 g/mol. Its IUPAC name is 6-[2-(3,4-dimethoxyphenyl)ethyl]-4-methoxypyran-2-one.
| Compound Name | 6-[2-(3,4-dimethoxyphenyl)ethyl]-4-methoxypyran-2-one |
|---|---|
| PubChem CID | 57400515 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 6-[2-(3,4-dimethoxyphenyl)ethyl]-4-methoxypyran-2-one |
| SMILES | COc1cc(CCc2ccc(OC)c(OC)c2)oc(=O)c1 |
| InChI | InChI=1S/C16H18O5/c1-18-13-9-12(21-16(17)10-13)6-4-11-5-7-14(19-2)15(8-11)20-3/h5,7-10H,4,6H2,1-3H3 |
| InChIKey | UACFBTNFAATILJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |