C26H26Cl2N2O7S — CID 57401589
[2-[(3,4-dichlorophenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-1-phenylethyl] 3-nitrobenzenesulfonate (PubChem CID 57401589) has the molecular formula C26H26Cl2N2O7S and a molecular weight of 581.47 g/mol. Its IUPAC name is [2-[(3,4-dichlorophenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-1-phenylethyl] 3-nitrobenzenesulfonate.
| Compound Name | [2-[(3,4-dichlorophenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-1-phenylethyl] 3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 57401589 |
| Molecular Formula | C26H26Cl2N2O7S |
| Molecular Weight | 581.47 g/mol |
| Exact Mass | 580.08 |
| IUPAC Name | [2-[(3,4-dichlorophenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-1-phenylethyl] 3-nitrobenzenesulfonate |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccc(Cl)c(Cl)c1)CC(OS(=O)(=O)c1cccc([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C26H26Cl2N2O7S/c1-26(2,3)36-25(31)29(16-18-12-13-22(27)23(28)14-18)17-24(19-8-5-4-6-9-19)37-38(34,35)21-11-7-10-20(15-21)30(32)33/h4-15,24H,16-17H2,1-3H3 |
| InChIKey | ZLZIDPIFIIHFJI-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.47 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|