C10H16N3O7P — CID 57401897
2-[(2R,3S,4R,5R)-4-amino-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]ethylphosphonic acid (PubChem CID 57401897) has the molecular formula C10H16N3O7P and a molecular weight of 321.23 g/mol. Its IUPAC name is 2-[(2R,3S,4R,5R)-4-amino-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]ethylphosphonic acid.
| Compound Name | 2-[(2R,3S,4R,5R)-4-amino-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 57401897 |
| Molecular Formula | C10H16N3O7P |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 2-[(2R,3S,4R,5R)-4-amino-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]ethylphosphonic acid |
| SMILES | N[C@@H]1[C@H](O)[C@@H](CCP(=O)(O)O)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C10H16N3O7P/c11-7-8(15)5(2-4-21(17,18)19)20-9(7)13-3-1-6(14)12-10(13)16/h1,3,5,7-9,15H,2,4,11H2,(H,12,14,16)(H2,17,18,19)/t5-,7-,8-,9-/m1/s1 |
| InChIKey | REPYPGXNEFJARW-ZOQUXTDFSA-N |
| XLogP | -2.31 |
| TPSA | 167.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|