C10H20ClN4O7P — CID 57398423
diazanium;1-[(2R,3R,4R,5R)-3-chloro-4-hydroxy-5-(2-phosphonatoethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 57398423) has the molecular formula C10H20ClN4O7P and a molecular weight of 374.72 g/mol. Its IUPAC name is diazanium;1-[(2R,3R,4R,5R)-3-chloro-4-hydroxy-5-(2-phosphonatoethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | diazanium;1-[(2R,3R,4R,5R)-3-chloro-4-hydroxy-5-(2-phosphonatoethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 57398423 |
| Molecular Formula | C10H20ClN4O7P |
| Molecular Weight | 374.72 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | diazanium;1-[(2R,3R,4R,5R)-3-chloro-4-hydroxy-5-(2-phosphonatoethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn([C@@H]2O[C@H](CCP(=O)([O-])[O-])[C@@H](O)[C@H]2Cl)c(=O)[nH]1.[NH4+].[NH4+] |
| InChI | InChI=1S/C10H14ClN2O7P.2H3N/c11-7-8(15)5(2-4-21(17,18)19)20-9(7)13-3-1-6(14)12-10(13)16;;/h1,3,5,7-9,15H,2,4H2,(H,12,14,16)(H2,17,18,19);2*1H3/t5-,7-,8-,9-;;/m1../s1 |
| InChIKey | YWXXWVSEJVWOID-BAZBJWKESA-N |
| XLogP | -1.54 |
| TPSA | 220.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.72 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|