C23H16N4O2 — CID 57404680
N-(5-pyridin-4-yliminobenzo[a]phenoxazin-9-yl)acetamide (PubChem CID 57404680) has the molecular formula C23H16N4O2 and a molecular weight of 380.41 g/mol. Its IUPAC name is N-(5-pyridin-4-yliminobenzo[a]phenoxazin-9-yl)acetamide.
| Compound Name | N-(5-pyridin-4-yliminobenzo[a]phenoxazin-9-yl)acetamide |
|---|---|
| PubChem CID | 57404680 |
| Molecular Formula | C23H16N4O2 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | N-(5-pyridin-4-yliminobenzo[a]phenoxazin-9-yl)acetamide |
| SMILES | CC(=O)Nc1ccc2nc3c4ccccc4/c(=N/c4ccncc4)cc-3oc2c1 |
| InChI | InChI=1S/C23H16N4O2/c1-14(28)25-16-6-7-19-21(12-16)29-22-13-20(26-15-8-10-24-11-9-15)17-4-2-3-5-18(17)23(22)27-19/h2-13H,1H3,(H,25,28)/b26-20+ |
| InChIKey | MCDRZFUWNRNVPA-LHLOQNFPSA-N |
| XLogP | 4.67 |
| TPSA | 80.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|