C41H31N7O2 — CID 6858061
5-[[6-[[9-(dimethylamino)benzo[a]phenoxazin-5-ylidene]amino]-2-pyridinyl]imino]-N,N-dimethylbenzo[a]phenoxazin-9-amine (PubChem CID 6858061) has the molecular formula C41H31N7O2 and a molecular weight of 653.75 g/mol. Its IUPAC name is 5-[[6-[[9-(dimethylamino)benzo[a]phenoxazin-5-ylidene]amino]-2-pyridinyl]imino]-N,N-dimethylbenzo[a]phenoxazin-9-amine.
| Compound Name | 5-[[6-[[9-(dimethylamino)benzo[a]phenoxazin-5-ylidene]amino]-2-pyridinyl]imino]-N,N-dimethylbenzo[a]phenoxazin-9-amine |
|---|---|
| PubChem CID | 6858061 |
| Molecular Formula | C41H31N7O2 |
| Molecular Weight | 653.75 g/mol |
| Exact Mass | 653.25 |
| IUPAC Name | 5-[[6-[[9-(dimethylamino)benzo[a]phenoxazin-5-ylidene]amino]-2-pyridinyl]imino]-N,N-dimethylbenzo[a]phenoxazin-9-amine |
| SMILES | CN(C)c1ccc2nc3c4ccccc4c(=Nc4cccc(/N=c5\cc6oc7cc(N(C)C)ccc7nc-6c6ccccc56)n4)cc-3oc2c1 |
| InChI | InChI=1S/C41H31N7O2/c1-47(2)24-16-18-30-34(20-24)49-36-22-32(26-10-5-7-12-28(26)40(36)44-30)42-38-14-9-15-39(46-38)43-33-23-37-41(29-13-8-6-11-27(29)33)45-31-19-17-25(48(3)4)21-35(31)50-37/h5-23H,1-4H3/b42-32+,43-33? |
| InChIKey | RDVRZIHSCNWPIR-DARFQNRHSA-N |
| XLogP | 8.48 |
| TPSA | 96.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.75 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|