C19H20Cl2N2O3 — CID 57406979
3-(2,4-dichlorophenoxy)-3-(4-phenoxypiperazin-1-yl)propanal (PubChem CID 57406979) has the molecular formula C19H20Cl2N2O3 and a molecular weight of 395.29 g/mol. Its IUPAC name is 3-(2,4-dichlorophenoxy)-3-(4-phenoxypiperazin-1-yl)propanal.
| Compound Name | 3-(2,4-dichlorophenoxy)-3-(4-phenoxypiperazin-1-yl)propanal |
|---|---|
| PubChem CID | 57406979 |
| Molecular Formula | C19H20Cl2N2O3 |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 3-(2,4-dichlorophenoxy)-3-(4-phenoxypiperazin-1-yl)propanal |
| SMILES | O=CCC(Oc1ccc(Cl)cc1Cl)N1CCN(Oc2ccccc2)CC1 |
| InChI | InChI=1S/C19H20Cl2N2O3/c20-15-6-7-18(17(21)14-15)25-19(8-13-24)22-9-11-23(12-10-22)26-16-4-2-1-3-5-16/h1-7,13-14,19H,8-12H2 |
| InChIKey | YDPMKVZORDGESO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|