C30H34O6S2Si2 — CID 57407588
trimethoxy-[5-[7-(5-trimethoxysilylthiophen-2-yl)-4,5,9,10-tetrahydropyren-2-yl]thiophen-2-yl]silane (PubChem CID 57407588) has the molecular formula C30H34O6S2Si2 and a molecular weight of 610.90 g/mol. Its IUPAC name is trimethoxy-[5-[7-(5-trimethoxysilylthiophen-2-yl)-4,5,9,10-tetrahydropyren-2-yl]thiophen-2-yl]silane.
| Compound Name | trimethoxy-[5-[7-(5-trimethoxysilylthiophen-2-yl)-4,5,9,10-tetrahydropyren-2-yl]thiophen-2-yl]silane |
|---|---|
| PubChem CID | 57407588 |
| Molecular Formula | C30H34O6S2Si2 |
| Molecular Weight | 610.90 g/mol |
| Exact Mass | 610.13 |
| IUPAC Name | trimethoxy-[5-[7-(5-trimethoxysilylthiophen-2-yl)-4,5,9,10-tetrahydropyren-2-yl]thiophen-2-yl]silane |
| SMILES | CO[Si](OC)(OC)c1ccc(-c2cc3c4c(c2)CCc2cc(-c5ccc([Si](OC)(OC)OC)s5)cc(c2-4)CC3)s1 |
| InChI | InChI=1S/C30H34O6S2Si2/c1-31-39(32-2,33-3)27-13-11-25(37-27)23-15-19-7-9-21-17-24(18-22-10-8-20(16-23)29(19)30(21)22)26-12-14-28(38-26)40(34-4,35-5)36-6/h11-18H,7-10H2,1-6H3 |
| InChIKey | DYGIUYNINWEWOY-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.90 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|