C20H24N2OSSi — CID 57412283
tert-butyl-dimethyl-[(5-phenyl-2-pyridin-2-yl-1,3-thiazol-4-yl)oxy]silane (PubChem CID 57412283) has the molecular formula C20H24N2OSSi and a molecular weight of 368.58 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(5-phenyl-2-pyridin-2-yl-1,3-thiazol-4-yl)oxy]silane.
| Compound Name | tert-butyl-dimethyl-[(5-phenyl-2-pyridin-2-yl-1,3-thiazol-4-yl)oxy]silane |
|---|---|
| PubChem CID | 57412283 |
| Molecular Formula | C20H24N2OSSi |
| Molecular Weight | 368.58 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | tert-butyl-dimethyl-[(5-phenyl-2-pyridin-2-yl-1,3-thiazol-4-yl)oxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1nc(-c2ccccn2)sc1-c1ccccc1 |
| InChI | InChI=1S/C20H24N2OSSi/c1-20(2,3)25(4,5)23-18-17(15-11-7-6-8-12-15)24-19(22-18)16-13-9-10-14-21-16/h6-14H,1-5H3 |
| InChIKey | TUBOPGLLPJRBMX-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.58 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|