C36H46N8O5 — CID 57415533
ethyl 3-[[1-methyl-2-[[4-[N'-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]carbamimidoyl]anilino]methyl]benzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate (PubChem CID 57415533) has the molecular formula C36H46N8O5 and a molecular weight of 670.82 g/mol. Its IUPAC name is ethyl 3-[[1-methyl-2-[[4-[N'-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]carbamimidoyl]anilino]methyl]benzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate.
| Compound Name | ethyl 3-[[1-methyl-2-[[4-[N'-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]carbamimidoyl]anilino]methyl]benzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate |
|---|---|
| PubChem CID | 57415533 |
| Molecular Formula | C36H46N8O5 |
| Molecular Weight | 670.82 g/mol |
| Exact Mass | 670.36 |
| IUPAC Name | ethyl 3-[[1-methyl-2-[[4-[N'-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]carbamimidoyl]anilino]methyl]benzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate |
| SMILES | CCOC(=O)CCN(C(=O)c1ccc2c(c1)nc(CNc1ccc(/C(N)=N/CCCCNC(=O)OC(C)(C)C)cc1)n2C)c1ccccn1 |
| InChI | InChI=1S/C36H46N8O5/c1-6-48-32(45)18-22-44(30-11-7-8-19-38-30)34(46)26-14-17-29-28(23-26)42-31(43(29)5)24-41-27-15-12-25(13-16-27)33(37)39-20-9-10-21-40-35(47)49-36(2,3)4/h7-8,11-17,19,23,41H,6,9-10,18,20-22,24H2,1-5H3,(H2,37,39)(H,40,47) |
| InChIKey | YYCNSLGAIMQGDG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 166.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.82 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|