C20H26ClN5O4Si — CID 57429315
2-[8-chloro-6-(2-methyl-4-trimethylsilylanilino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 57429315) has the molecular formula C20H26ClN5O4Si and a molecular weight of 464.00 g/mol. Its IUPAC name is 2-[8-chloro-6-(2-methyl-4-trimethylsilylanilino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | 2-[8-chloro-6-(2-methyl-4-trimethylsilylanilino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 57429315 |
| Molecular Formula | C20H26ClN5O4Si |
| Molecular Weight | 464.00 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | 2-[8-chloro-6-(2-methyl-4-trimethylsilylanilino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Cc1cc([Si](C)(C)C)ccc1Nc1ncnc2c1nc(Cl)n2C1OC(CO)C(O)C1O |
| InChI | InChI=1S/C20H26ClN5O4Si/c1-10-7-11(31(2,3)4)5-6-12(10)24-17-14-18(23-9-22-17)26(20(21)25-14)19-16(29)15(28)13(8-27)30-19/h5-7,9,13,15-16,19,27-29H,8H2,1-4H3,(H,22,23,24) |
| InChIKey | ONGLGUPADYZVFX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.00 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|