C10H14O3 — CID 574323
spiro[1,3-dioxolane-2,8'-3-oxatricyclo[4.3.0.02,4]nonane] (PubChem CID 574323) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is spiro[1,3-dioxolane-2,8'-3-oxatricyclo[4.3.0.02,4]nonane].
| Compound Name | spiro[1,3-dioxolane-2,8'-3-oxatricyclo[4.3.0.02,4]nonane] |
|---|---|
| PubChem CID | 574323 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | spiro[1,3-dioxolane-2,8'-3-oxatricyclo[4.3.0.02,4]nonane] |
| SMILES | C1COC2(CC3CC4OC4C3C2)O1 |
| InChI | InChI=1S/C10H14O3/c1-2-12-10(11-1)4-6-3-8-9(13-8)7(6)5-10/h6-9H,1-5H2 |
| InChIKey | XJLFCNVYYFQEGU-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|