C23H31N5O7 — CID 57444861
tert-butyl 2-[6-[3-(2-methoxyethylcarbamoyl)-5-nitrophenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetate (PubChem CID 57444861) has the molecular formula C23H31N5O7 and a molecular weight of 489.53 g/mol. Its IUPAC name is tert-butyl 2-[6-[3-(2-methoxyethylcarbamoyl)-5-nitrophenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetate.
| Compound Name | tert-butyl 2-[6-[3-(2-methoxyethylcarbamoyl)-5-nitrophenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetate |
|---|---|
| PubChem CID | 57444861 |
| Molecular Formula | C23H31N5O7 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | tert-butyl 2-[6-[3-(2-methoxyethylcarbamoyl)-5-nitrophenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetate |
| SMILES | COCCNC(=O)c1cc(-c2cnc(NC(C)C)c(=O)n2CC(=O)OC(C)(C)C)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H31N5O7/c1-14(2)26-20-22(31)27(13-19(29)35-23(3,4)5)18(12-25-20)15-9-16(11-17(10-15)28(32)33)21(30)24-7-8-34-6/h9-12,14H,7-8,13H2,1-6H3,(H,24,30)(H,25,26) |
| InChIKey | KRGDTVIXMIASBF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 154.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|