C17H14FNO3 — CID 57445406
4-benzoyl-1-(3-fluoro-4-hydroxyphenyl)pyrrolidin-2-one (PubChem CID 57445406) has the molecular formula C17H14FNO3 and a molecular weight of 299.30 g/mol. Its IUPAC name is 4-benzoyl-1-(3-fluoro-4-hydroxyphenyl)pyrrolidin-2-one.
| Compound Name | 4-benzoyl-1-(3-fluoro-4-hydroxyphenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 57445406 |
| Molecular Formula | C17H14FNO3 |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 4-benzoyl-1-(3-fluoro-4-hydroxyphenyl)pyrrolidin-2-one |
| SMILES | O=C(c1ccccc1)C1CC(=O)N(c2ccc(O)c(F)c2)C1 |
| InChI | InChI=1S/C17H14FNO3/c18-14-9-13(6-7-15(14)20)19-10-12(8-16(19)21)17(22)11-4-2-1-3-5-11/h1-7,9,12,20H,8,10H2 |
| InChIKey | WXAJTXBSTYMUME-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |