C10H14N2O2 — CID 57458781
2-amino-4-benzyl-1,3-oxazolidin-2-ol (PubChem CID 57458781) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 2-amino-4-benzyl-1,3-oxazolidin-2-ol.
| Compound Name | 2-amino-4-benzyl-1,3-oxazolidin-2-ol |
|---|---|
| PubChem CID | 57458781 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 2-amino-4-benzyl-1,3-oxazolidin-2-ol |
| SMILES | NC1(O)NC(Cc2ccccc2)CO1 |
| InChI | InChI=1S/C10H14N2O2/c11-10(13)12-9(7-14-10)6-8-4-2-1-3-5-8/h1-5,9,12-13H,6-7,11H2 |
| InChIKey | QGXGBMHTXWNCDS-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|