About 2-amino-4-benzyl-1,3-oxazolidin-2-ol
2-amino-4-benzyl-1,3-oxazolidin-2-ol (PubChem CID 57458781) has the molecular formula C10H14N2O2
and a molecular weight of 194.23 g/mol. Its IUPAC name is 2-amino-4-benzyl-1,3-oxazolidin-2-ol.
Molecular Properties
| Compound Name | 2-amino-4-benzyl-1,3-oxazolidin-2-ol |
| PubChem CID | 57458781 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 2-amino-4-benzyl-1,3-oxazolidin-2-ol |
| SMILES | NC1(O)NC(Cc2ccccc2)CO1 |
| InChI | InChI=1S/C10H14N2O2/c11-10(13)12-9(7-14-10)6-8-4-2-1-3-5-8/h1-5,9,12-13H,6-7,11H2 |
| InChIKey | QGXGBMHTXWNCDS-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-benzyl-1,3-oxazolidin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-benzyl-1,3-oxazolidin-2-ol?
The IUPAC name of 2-amino-4-benzyl-1,3-oxazolidin-2-ol (CID 57458781) is 2-amino-4-benzyl-1,3-oxazolidin-2-ol.
What is the SMILES notation for 2-amino-4-benzyl-1,3-oxazolidin-2-ol?
The canonical SMILES for 2-amino-4-benzyl-1,3-oxazolidin-2-ol is NC1(O)NC(Cc2ccccc2)CO1.
What is the InChIKey of 2-amino-4-benzyl-1,3-oxazolidin-2-ol?
The InChIKey is QGXGBMHTXWNCDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2/c11-10(13)12-9(7-14-10)6-8-4-2-1-3-5-8/h1-5,9,12-13H,6-7,11H2.
What are the key properties of 2-amino-4-benzyl-1,3-oxazolidin-2-ol?
2-amino-4-benzyl-1,3-oxazolidin-2-ol has a molecular weight of 194.23 g/mol, XLogP of -0.22, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-benzyl-1,3-oxazolidin-2-ol is sourced from PubChem (CID 57458781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).