C20H33Cl2N5 — CID 57479512
2-N-[5-(2,4-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-yl]-1-N,1-N,2-N',2-N'-tetraethylpropane-1,2,2-triamine (PubChem CID 57479512) has the molecular formula C20H33Cl2N5 and a molecular weight of 414.43 g/mol. Its IUPAC name is 2-N-[5-(2,4-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-yl]-1-N,1-N,2-N',2-N'-tetraethylpropane-1,2,2-triamine.
| Compound Name | 2-N-[5-(2,4-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-yl]-1-N,1-N,2-N',2-N'-tetraethylpropane-1,2,2-triamine |
|---|---|
| PubChem CID | 57479512 |
| Molecular Formula | C20H33Cl2N5 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 2-N-[5-(2,4-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-yl]-1-N,1-N,2-N',2-N'-tetraethylpropane-1,2,2-triamine |
| SMILES | CCN(CC)CC(C)(NC1=NCC(c2ccc(Cl)cc2Cl)N1)N(CC)CC |
| InChI | InChI=1S/C20H33Cl2N5/c1-6-26(7-2)14-20(5,27(8-3)9-4)25-19-23-13-18(24-19)16-11-10-15(21)12-17(16)22/h10-12,18H,6-9,13-14H2,1-5H3,(H2,23,24,25) |
| InChIKey | AXHALXUWGWZCQX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|