C31H34O7S — CID 57536994
methyl (3R,4S,6R)-6-(acetylsulfanylmethyl)-3,4,5-tris(phenylmethoxy)oxane-2-carboxylate (PubChem CID 57536994) has the molecular formula C31H34O7S and a molecular weight of 550.70 g/mol. Its IUPAC name is methyl (3R,4S,6R)-6-(acetylsulfanylmethyl)-3,4,5-tris(phenylmethoxy)oxane-2-carboxylate.
| Compound Name | methyl (3R,4S,6R)-6-(acetylsulfanylmethyl)-3,4,5-tris(phenylmethoxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 57536994 |
| Molecular Formula | C31H34O7S |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | methyl (3R,4S,6R)-6-(acetylsulfanylmethyl)-3,4,5-tris(phenylmethoxy)oxane-2-carboxylate |
| SMILES | CC(=O)SC[C@H]1C([C@H]([C@H](C(O1)C(=O)OC)OCC2=CC=CC=C2)OCC3=CC=CC=C3)OCC4=CC=CC=C4 |
| InChI | InChI=1S/C31H34O7S/c1-22(32)39-21-26-27(35-18-23-12-6-3-7-13-23)28(36-19-24-14-8-4-9-15-24)29(30(38-26)31(33)34-2)37-20-25-16-10-5-11-17-25/h3-17,26-30H,18-21H2,1-2H3/t26-,27?,28+,29+,30?/m0/s1 |
| InChIKey | ORFTWIIOBLORHF-VLRXRCSNSA-N |
| XLogP | 4.50 |
| TPSA | 106.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | 730 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|