About 1-oxospiro[2,4-dihydronaphthalene-3,1'-cyclopentane]-2-carbonitrile
1-oxospiro[2,4-dihydronaphthalene-3,1'-cyclopentane]-2-carbonitrile (PubChem CID 576312) has the molecular formula C15H15NO
and a molecular weight of 225.29 g/mol. Its IUPAC name is 1-oxospiro[2,4-dihydronaphthalene-3,1'-cyclopentane]-2-carbonitrile.
Molecular Properties
| Compound Name | 1-oxospiro[2,4-dihydronaphthalene-3,1'-cyclopentane]-2-carbonitrile |
| PubChem CID | 576312 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 1-oxospiro[2,4-dihydronaphthalene-3,1'-cyclopentane]-2-carbonitrile |
| SMILES | N#CC1C(=O)c2ccccc2CC12CCCC2 |
| InChI | InChI=1S/C15H15NO/c16-10-13-14(17)12-6-2-1-5-11(12)9-15(13)7-3-4-8-15/h1-2,5-6,13H,3-4,7-9H2 |
| InChIKey | ACXBTIAOZQVLNL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-oxospiro[2,4-dihydronaphthalene-3,1'-cyclopentane]-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxospiro[2,4-dihydronaphthalene-3,1'-cyclopentane]-2-carbonitrile?
The IUPAC name of 1-oxospiro[2,4-dihydronaphthalene-3,1'-cyclopentane]-2-carbonitrile (CID 576312) is 1-oxospiro[2,4-dihydronaphthalene-3,1'-cyclopentane]-2-carbonitrile.
What is the SMILES notation for 1-oxospiro[2,4-dihydronaphthalene-3,1'-cyclopentane]-2-carbonitrile?
The canonical SMILES for 1-oxospiro[2,4-dihydronaphthalene-3,1'-cyclopentane]-2-carbonitrile is N#CC1C(=O)c2ccccc2CC12CCCC2.
What is the InChIKey of 1-oxospiro[2,4-dihydronaphthalene-3,1'-cyclopentane]-2-carbonitrile?
The InChIKey is ACXBTIAOZQVLNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO/c16-10-13-14(17)12-6-2-1-5-11(12)9-15(13)7-3-4-8-15/h1-2,5-6,13H,3-4,7-9H2.
What are the key properties of 1-oxospiro[2,4-dihydronaphthalene-3,1'-cyclopentane]-2-carbonitrile?
1-oxospiro[2,4-dihydronaphthalene-3,1'-cyclopentane]-2-carbonitrile has a molecular weight of 225.29 g/mol, XLogP of 3.13, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxospiro[2,4-dihydronaphthalene-3,1'-cyclopentane]-2-carbonitrile is sourced from PubChem (CID 576312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).