C22H33ClFN7O3 — CID 58000526
N-[(2R)-3-[2-[2-chloro-6-[7-(dimethylamino)-5-azaspiro[2.4]heptan-5-yl]-5-fluoropyrimidin-4-yl]hydrazinyl]-2-(cyclopentylmethyl)-3-oxopropyl]-N-hydroxyformamide (PubChem CID 58000526) has the molecular formula C22H33ClFN7O3 and a molecular weight of 498.00 g/mol. Its IUPAC name is N-[(2R)-3-[2-[2-chloro-6-[7-(dimethylamino)-5-azaspiro[2.4]heptan-5-yl]-5-fluoropyrimidin-4-yl]hydrazinyl]-2-(cyclopentylmethyl)-3-oxopropyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-3-[2-[2-chloro-6-[7-(dimethylamino)-5-azaspiro[2.4]heptan-5-yl]-5-fluoropyrimidin-4-yl]hydrazinyl]-2-(cyclopentylmethyl)-3-oxopropyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 58000526 |
| Molecular Formula | C22H33ClFN7O3 |
| Molecular Weight | 498.00 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | N-[(2R)-3-[2-[2-chloro-6-[7-(dimethylamino)-5-azaspiro[2.4]heptan-5-yl]-5-fluoropyrimidin-4-yl]hydrazinyl]-2-(cyclopentylmethyl)-3-oxopropyl]-N-hydroxyformamide |
| SMILES | CN(C)C1CN(c2nc(Cl)nc(NNC(=O)[C@H](CC3CCCC3)CN(O)C=O)c2F)CC12CC2 |
| InChI | InChI=1S/C22H33ClFN7O3/c1-29(2)16-11-30(12-22(16)7-8-22)19-17(24)18(25-21(23)26-19)27-28-20(33)15(10-31(34)13-32)9-14-5-3-4-6-14/h13-16,34H,3-12H2,1-2H3,(H,28,33)(H,25,26,27)/t15-,16?/m1/s1 |
| InChIKey | MDDPXBKWEUYOEI-AAFJCEBUSA-N |
| XLogP | 2.29 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.00 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|