C16H12F6N2OS — CID 58003590
4-[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)furan-2-yl]-N,N-dimethyl-1,3-benzothiazol-2-amine (PubChem CID 58003590) has the molecular formula C16H12F6N2OS and a molecular weight of 394.34 g/mol. Its IUPAC name is 4-[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)furan-2-yl]-N,N-dimethyl-1,3-benzothiazol-2-amine.
| Compound Name | 4-[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)furan-2-yl]-N,N-dimethyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 58003590 |
| Molecular Formula | C16H12F6N2OS |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 4-[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)furan-2-yl]-N,N-dimethyl-1,3-benzothiazol-2-amine |
| SMILES | CN(C)c1nc2c(-c3ccc(C(C(F)(F)F)C(F)(F)F)o3)cccc2s1 |
| InChI | InChI=1S/C16H12F6N2OS/c1-24(2)14-23-12-8(4-3-5-11(12)26-14)9-6-7-10(25-9)13(15(17,18)19)16(20,21)22/h3-7,13H,1-2H3 |
| InChIKey | KHSAMLWGXFGXKJ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |