C13H7ClN2O2S — CID 101236232
(2S)-2-[5-(4-chloro-1,3-benzothiazol-2-yl)furan-2-yl]-2-hydroxyacetonitrile (PubChem CID 101236232) has the molecular formula C13H7ClN2O2S and a molecular weight of 290.73 g/mol. Its IUPAC name is (2S)-2-[5-(4-chloro-1,3-benzothiazol-2-yl)furan-2-yl]-2-hydroxyacetonitrile.
| Compound Name | (2S)-2-[5-(4-chloro-1,3-benzothiazol-2-yl)furan-2-yl]-2-hydroxyacetonitrile |
|---|---|
| PubChem CID | 101236232 |
| Molecular Formula | C13H7ClN2O2S |
| Molecular Weight | 290.73 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | (2S)-2-[5-(4-chloro-1,3-benzothiazol-2-yl)furan-2-yl]-2-hydroxyacetonitrile |
| SMILES | N#C[C@H](O)c1ccc(-c2nc3c(Cl)cccc3s2)o1 |
| InChI | InChI=1S/C13H7ClN2O2S/c14-7-2-1-3-11-12(7)16-13(19-11)10-5-4-9(18-10)8(17)6-15/h1-5,8,17H/t8-/m0/s1 |
| InChIKey | MJZLXJSWVRBUQI-QMMMGPOBSA-N |
| XLogP | 3.77 |
| TPSA | 70.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.73 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|