C15H27F3N2O4 — CID 58007136
tert-butyl N-[2-[2-[methyl-(2,2,2-trifluoroacetyl)amino]ethoxy]ethyl]-N-propan-2-ylcarbamate (PubChem CID 58007136) has the molecular formula C15H27F3N2O4 and a molecular weight of 356.39 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[methyl-(2,2,2-trifluoroacetyl)amino]ethoxy]ethyl]-N-propan-2-ylcarbamate.
| Compound Name | tert-butyl N-[2-[2-[methyl-(2,2,2-trifluoroacetyl)amino]ethoxy]ethyl]-N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 58007136 |
| Molecular Formula | C15H27F3N2O4 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | tert-butyl N-[2-[2-[methyl-(2,2,2-trifluoroacetyl)amino]ethoxy]ethyl]-N-propan-2-ylcarbamate |
| SMILES | CC(C)N(CCOCCN(C)C(=O)C(F)(F)F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H27F3N2O4/c1-11(2)20(13(22)24-14(3,4)5)8-10-23-9-7-19(6)12(21)15(16,17)18/h11H,7-10H2,1-6H3 |
| InChIKey | YIZYMRKFWZJCNV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|