C26H17BrO5 — CID 58008459
9-(4-bromophenyl)-8-(2-methoxybenzoyl)-4-methylfuro[2,3-h]chromen-2-one (PubChem CID 58008459) has the molecular formula C26H17BrO5 and a molecular weight of 489.32 g/mol. Its IUPAC name is 9-(4-bromophenyl)-8-(2-methoxybenzoyl)-4-methylfuro[2,3-h]chromen-2-one.
| Compound Name | 9-(4-bromophenyl)-8-(2-methoxybenzoyl)-4-methylfuro[2,3-h]chromen-2-one |
|---|---|
| PubChem CID | 58008459 |
| Molecular Formula | C26H17BrO5 |
| Molecular Weight | 489.32 g/mol |
| Exact Mass | 488.03 |
| IUPAC Name | 9-(4-bromophenyl)-8-(2-methoxybenzoyl)-4-methylfuro[2,3-h]chromen-2-one |
| SMILES | COc1ccccc1C(=O)c1oc2ccc3c(C)cc(=O)oc3c2c1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C26H17BrO5/c1-14-13-21(28)32-25-17(14)11-12-20-23(25)22(15-7-9-16(27)10-8-15)26(31-20)24(29)18-5-3-4-6-19(18)30-2/h3-13H,1-2H3 |
| InChIKey | RUNHJAMLNREBPH-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 69.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.32 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|