C20H39N3O7 — CID 58019737
ethyl 4-[3-aminopropyl-[3-[3-[2-(2-methoxyethoxy)ethoxy]propanoylamino]propyl]amino]-4-oxobutanoate (PubChem CID 58019737) has the molecular formula C20H39N3O7 and a molecular weight of 433.55 g/mol. Its IUPAC name is ethyl 4-[3-aminopropyl-[3-[3-[2-(2-methoxyethoxy)ethoxy]propanoylamino]propyl]amino]-4-oxobutanoate.
| Compound Name | ethyl 4-[3-aminopropyl-[3-[3-[2-(2-methoxyethoxy)ethoxy]propanoylamino]propyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 58019737 |
| Molecular Formula | C20H39N3O7 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | ethyl 4-[3-aminopropyl-[3-[3-[2-(2-methoxyethoxy)ethoxy]propanoylamino]propyl]amino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)N(CCCN)CCCNC(=O)CCOCCOCCOC |
| InChI | InChI=1S/C20H39N3O7/c1-3-30-20(26)7-6-19(25)23(11-4-9-21)12-5-10-22-18(24)8-13-28-16-17-29-15-14-27-2/h3-17,21H2,1-2H3,(H,22,24) |
| InChIKey | OHFFCNUDSLVVKX-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 129.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|