C18H35N3O8 — CID 175882329
3-aminopropyl 3-[3-[2-[2-[2-(ethoxycarbonylamino)ethoxy]ethoxy]ethoxy]propanoylamino]propanoate (PubChem CID 175882329) has the molecular formula C18H35N3O8 and a molecular weight of 421.49 g/mol. Its IUPAC name is 3-aminopropyl 3-[3-[2-[2-[2-(ethoxycarbonylamino)ethoxy]ethoxy]ethoxy]propanoylamino]propanoate.
| Compound Name | 3-aminopropyl 3-[3-[2-[2-[2-(ethoxycarbonylamino)ethoxy]ethoxy]ethoxy]propanoylamino]propanoate |
|---|---|
| PubChem CID | 175882329 |
| Molecular Formula | C18H35N3O8 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 3-aminopropyl 3-[3-[2-[2-[2-(ethoxycarbonylamino)ethoxy]ethoxy]ethoxy]propanoylamino]propanoate |
| SMILES | CCOC(=O)NCCOCCOCCOCCC(=O)NCCC(=O)OCCCN |
| InChI | InChI=1S/C18H35N3O8/c1-2-28-18(24)21-8-11-26-13-15-27-14-12-25-10-5-16(22)20-7-4-17(23)29-9-3-6-19/h2-15,19H2,1H3,(H,20,22)(H,21,24) |
| InChIKey | AITNSOQFSAMYSR-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 147.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|