C24H24FNO3 — CID 58032377
(2R)-3-[4-(2-cyclopropylethynyl)-3-fluorophenyl]-2-[(4-propan-2-ylbenzoyl)amino]propanoic acid (PubChem CID 58032377) has the molecular formula C24H24FNO3 and a molecular weight of 393.46 g/mol. Its IUPAC name is (2R)-3-[4-(2-cyclopropylethynyl)-3-fluorophenyl]-2-[(4-propan-2-ylbenzoyl)amino]propanoic acid.
| Compound Name | (2R)-3-[4-(2-cyclopropylethynyl)-3-fluorophenyl]-2-[(4-propan-2-ylbenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 58032377 |
| Molecular Formula | C24H24FNO3 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | (2R)-3-[4-(2-cyclopropylethynyl)-3-fluorophenyl]-2-[(4-propan-2-ylbenzoyl)amino]propanoic acid |
| SMILES | CC(C)c1ccc(C(=O)N[C@H](Cc2ccc(C#CC3CC3)c(F)c2)C(=O)O)cc1 |
| InChI | InChI=1S/C24H24FNO3/c1-15(2)18-9-11-20(12-10-18)23(27)26-22(24(28)29)14-17-6-8-19(21(25)13-17)7-5-16-3-4-16/h6,8-13,15-16,22H,3-4,14H2,1-2H3,(H,26,27)(H,28,29)/t22-/m1/s1 |
| InChIKey | DKMJQYXXUYXMPP-JOCHJYFZSA-N |
| XLogP | 4.14 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|