C18H13N3O5 — CID 88920387
2-[(4-isocyanatobenzoyl)amino]-3-(4-isocyanatophenyl)propanoic acid (PubChem CID 88920387) has the molecular formula C18H13N3O5 and a molecular weight of 351.32 g/mol. Its IUPAC name is 2-[(4-isocyanatobenzoyl)amino]-3-(4-isocyanatophenyl)propanoic acid.
| Compound Name | 2-[(4-isocyanatobenzoyl)amino]-3-(4-isocyanatophenyl)propanoic acid |
|---|---|
| PubChem CID | 88920387 |
| Molecular Formula | C18H13N3O5 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 2-[(4-isocyanatobenzoyl)amino]-3-(4-isocyanatophenyl)propanoic acid |
| SMILES | O=C=Nc1ccc(CC(NC(=O)c2ccc(N=C=O)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C18H13N3O5/c22-10-19-14-5-1-12(2-6-14)9-16(18(25)26)21-17(24)13-3-7-15(8-4-13)20-11-23/h1-8,16H,9H2,(H,21,24)(H,25,26) |
| InChIKey | OTGHVFTZZLDVPV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 125.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|