C23H21ClN4O2 — CID 58035699
4-[5-[(2R,3S)-1-(3-chloro-4-isocyano-2-propylphenyl)-3-hydroxybutan-2-yl]-1,3,4-oxadiazol-2-yl]benzonitrile (PubChem CID 58035699) has the molecular formula C23H21ClN4O2 and a molecular weight of 420.90 g/mol. Its IUPAC name is 4-[5-[(2R,3S)-1-(3-chloro-4-isocyano-2-propylphenyl)-3-hydroxybutan-2-yl]-1,3,4-oxadiazol-2-yl]benzonitrile.
| Compound Name | 4-[5-[(2R,3S)-1-(3-chloro-4-isocyano-2-propylphenyl)-3-hydroxybutan-2-yl]-1,3,4-oxadiazol-2-yl]benzonitrile |
|---|---|
| PubChem CID | 58035699 |
| Molecular Formula | C23H21ClN4O2 |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 4-[5-[(2R,3S)-1-(3-chloro-4-isocyano-2-propylphenyl)-3-hydroxybutan-2-yl]-1,3,4-oxadiazol-2-yl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(C[C@@H](c2nnc(-c3ccc(C#N)cc3)o2)[C@H](C)O)c(CCC)c1Cl |
| InChI | InChI=1S/C23H21ClN4O2/c1-4-5-18-17(10-11-20(26-3)21(18)24)12-19(14(2)29)23-28-27-22(30-23)16-8-6-15(13-25)7-9-16/h6-11,14,19,29H,4-5,12H2,1-2H3/t14-,19+/m0/s1 |
| InChIKey | WTHUQHUKBPXWNT-IFXJQAMLSA-N |
| XLogP | 5.47 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|