C28H29ClFN3O5 — CID 58433554
[5-[5-[(2R,3R)-3-butanoyloxy-1-(3-chloro-4-isocyano-2-methylphenyl)butan-2-yl]-1,3,4-oxadiazol-2-yl]-2-fluorophenyl] butanoate (PubChem CID 58433554) has the molecular formula C28H29ClFN3O5 and a molecular weight of 542.01 g/mol. Its IUPAC name is [5-[5-[(2R,3R)-3-butanoyloxy-1-(3-chloro-4-isocyano-2-methylphenyl)butan-2-yl]-1,3,4-oxadiazol-2-yl]-2-fluorophenyl] butanoate.
| Compound Name | [5-[5-[(2R,3R)-3-butanoyloxy-1-(3-chloro-4-isocyano-2-methylphenyl)butan-2-yl]-1,3,4-oxadiazol-2-yl]-2-fluorophenyl] butanoate |
|---|---|
| PubChem CID | 58433554 |
| Molecular Formula | C28H29ClFN3O5 |
| Molecular Weight | 542.01 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | [5-[5-[(2R,3R)-3-butanoyloxy-1-(3-chloro-4-isocyano-2-methylphenyl)butan-2-yl]-1,3,4-oxadiazol-2-yl]-2-fluorophenyl] butanoate |
| SMILES | [C-]#[N+]c1ccc(C[C@@H](c2nnc(-c3ccc(F)c(OC(=O)CCC)c3)o2)[C@@H](C)OC(=O)CCC)c(C)c1Cl |
| InChI | InChI=1S/C28H29ClFN3O5/c1-6-8-24(34)36-17(4)20(14-18-11-13-22(31-5)26(29)16(18)3)28-33-32-27(38-28)19-10-12-21(30)23(15-19)37-25(35)9-7-2/h10-13,15,17,20H,6-9,14H2,1-4H3/t17-,20-/m1/s1 |
| InChIKey | ZGTNSMGWDBFPRI-YLJYHZDGSA-N |
| XLogP | 7.15 |
| TPSA | 95.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.01 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|