C20H16Cl3N3O2 — CID 58433641
(2S,3R)-4-(3-chloro-4-isocyano-2-methylphenyl)-3-[5-(3,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]butan-2-ol (PubChem CID 58433641) has the molecular formula C20H16Cl3N3O2 and a molecular weight of 436.73 g/mol. Its IUPAC name is (2S,3R)-4-(3-chloro-4-isocyano-2-methylphenyl)-3-[5-(3,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]butan-2-ol.
| Compound Name | (2S,3R)-4-(3-chloro-4-isocyano-2-methylphenyl)-3-[5-(3,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]butan-2-ol |
|---|---|
| PubChem CID | 58433641 |
| Molecular Formula | C20H16Cl3N3O2 |
| Molecular Weight | 436.73 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | (2S,3R)-4-(3-chloro-4-isocyano-2-methylphenyl)-3-[5-(3,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]butan-2-ol |
| SMILES | [C-]#[N+]c1ccc(C[C@@H](c2nnc(-c3ccc(Cl)c(Cl)c3)o2)[C@H](C)O)c(C)c1Cl |
| InChI | InChI=1S/C20H16Cl3N3O2/c1-10-12(5-7-17(24-3)18(10)23)8-14(11(2)27)20-26-25-19(28-20)13-4-6-15(21)16(22)9-13/h4-7,9,11,14,27H,8H2,1-2H3/t11-,14+/m0/s1 |
| InChIKey | LBBJQBFORYJZKJ-SMDDNHRTSA-N |
| XLogP | 6.26 |
| TPSA | 63.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.73 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|