C24H22ClN3O5 — CID 58433540
[4-[5-[(2R,3S)-3-acetyloxy-1-(3-chloro-4-isocyano-2-methylphenyl)butan-2-yl]-1,3,4-oxadiazol-2-yl]phenyl] acetate (PubChem CID 58433540) has the molecular formula C24H22ClN3O5 and a molecular weight of 467.91 g/mol. Its IUPAC name is [4-[5-[(2R,3S)-3-acetyloxy-1-(3-chloro-4-isocyano-2-methylphenyl)butan-2-yl]-1,3,4-oxadiazol-2-yl]phenyl] acetate.
| Compound Name | [4-[5-[(2R,3S)-3-acetyloxy-1-(3-chloro-4-isocyano-2-methylphenyl)butan-2-yl]-1,3,4-oxadiazol-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 58433540 |
| Molecular Formula | C24H22ClN3O5 |
| Molecular Weight | 467.91 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | [4-[5-[(2R,3S)-3-acetyloxy-1-(3-chloro-4-isocyano-2-methylphenyl)butan-2-yl]-1,3,4-oxadiazol-2-yl]phenyl] acetate |
| SMILES | [C-]#[N+]c1ccc(C[C@@H](c2nnc(-c3ccc(OC(C)=O)cc3)o2)[C@H](C)OC(C)=O)c(C)c1Cl |
| InChI | InChI=1S/C24H22ClN3O5/c1-13-18(8-11-21(26-5)22(13)25)12-20(14(2)31-15(3)29)24-28-27-23(33-24)17-6-9-19(10-7-17)32-16(4)30/h6-11,14,20H,12H2,1-4H3/t14-,20+/m0/s1 |
| InChIKey | KRNDVDDQUBGZQV-VBKZILBWSA-N |
| XLogP | 5.45 |
| TPSA | 95.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.91 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|