About iridium;N-methyl-1-[3-(3-methyl-3H-pyrazol-2-id-1-yl)benzene-4-id-1-yl]methanamine
iridium;N-methyl-1-[3-(3-methyl-3H-pyrazol-2-id-1-yl)benzene-4-id-1-yl]methanamine (PubChem CID 58038517) has the molecular formula C12H15IrN3-2
and a molecular weight of 393.49 g/mol. Its IUPAC name is iridium;N-methyl-1-[3-(3-methyl-3H-pyrazol-2-id-1-yl)benzene-4-id-1-yl]methanamine.
Molecular Properties
| Compound Name | iridium;N-methyl-1-[3-(3-methyl-3H-pyrazol-2-id-1-yl)benzene-4-id-1-yl]methanamine |
| PubChem CID | 58038517 |
| Molecular Formula | C12H15IrN3-2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | iridium;N-methyl-1-[3-(3-methyl-3H-pyrazol-2-id-1-yl)benzene-4-id-1-yl]methanamine |
| SMILES | CNCc1cc[c-]c(N2C=CC(C)[N-]2)c1.[Ir] |
| InChI | InChI=1S/C12H15N3.Ir/c1-10-6-7-15(14-10)12-5-3-4-11(8-12)9-13-2;/h3-4,6-8,10,13H,9H2,1-2H3;/q-2; |
| InChIKey | JSPVVKAJNOYGJF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 29.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze iridium;N-methyl-1-[3-(3-methyl-3H-pyrazol-2-id-1-yl)benzene-4-id-1-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;N-methyl-1-[3-(3-methyl-3H-pyrazol-2-id-1-yl)benzene-4-id-1-yl]methanamine?
The IUPAC name of iridium;N-methyl-1-[3-(3-methyl-3H-pyrazol-2-id-1-yl)benzene-4-id-1-yl]methanamine (CID 58038517) is iridium;N-methyl-1-[3-(3-methyl-3H-pyrazol-2-id-1-yl)benzene-4-id-1-yl]methanamine.
What is the SMILES notation for iridium;N-methyl-1-[3-(3-methyl-3H-pyrazol-2-id-1-yl)benzene-4-id-1-yl]methanamine?
The canonical SMILES for iridium;N-methyl-1-[3-(3-methyl-3H-pyrazol-2-id-1-yl)benzene-4-id-1-yl]methanamine is CNCc1cc[c-]c(N2C=CC(C)[N-]2)c1.[Ir].
What is the InChIKey of iridium;N-methyl-1-[3-(3-methyl-3H-pyrazol-2-id-1-yl)benzene-4-id-1-yl]methanamine?
The InChIKey is JSPVVKAJNOYGJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3.Ir/c1-10-6-7-15(14-10)12-5-3-4-11(8-12)9-13-2;/h3-4,6-8,10,13H,9H2,1-2H3;/q-2;.
What are the key properties of iridium;N-methyl-1-[3-(3-methyl-3H-pyrazol-2-id-1-yl)benzene-4-id-1-yl]methanamine?
iridium;N-methyl-1-[3-(3-methyl-3H-pyrazol-2-id-1-yl)benzene-4-id-1-yl]methanamine has a molecular weight of 393.49 g/mol, XLogP of 2.21, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;N-methyl-1-[3-(3-methyl-3H-pyrazol-2-id-1-yl)benzene-4-id-1-yl]methanamine is sourced from PubChem (CID 58038517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).