C12H15IrN3-2 — CID 59582836
iridium;N-methyl-1-[3-(3-methyl-2H-imidazol-2-id-1-yl)benzene-4-id-1-yl]methanamine (PubChem CID 59582836) has the molecular formula C12H15IrN3-2 and a molecular weight of 393.49 g/mol. Its IUPAC name is iridium;N-methyl-1-[3-(3-methyl-2H-imidazol-2-id-1-yl)benzene-4-id-1-yl]methanamine.
| Compound Name | iridium;N-methyl-1-[3-(3-methyl-2H-imidazol-2-id-1-yl)benzene-4-id-1-yl]methanamine |
|---|---|
| PubChem CID | 59582836 |
| Molecular Formula | C12H15IrN3-2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | iridium;N-methyl-1-[3-(3-methyl-2H-imidazol-2-id-1-yl)benzene-4-id-1-yl]methanamine |
| SMILES | CNCc1cc[c-]c(N2C=CN(C)[CH-]2)c1.[Ir] |
| InChI | InChI=1S/C12H15N3.Ir/c1-13-9-11-4-3-5-12(8-11)15-7-6-14(2)10-15;/h3-4,6-8,10,13H,9H2,1-2H3;/q-2; |
| InChIKey | QXLXNLDGLABYGJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|