C28H24N4O6 — CID 58042235
7-[2-[(4R)-4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]spiro[2,3-dihydro-1H-naphthalene-4,5'-pyrrolidine]-2',4'-dione (PubChem CID 58042235) has the molecular formula C28H24N4O6 and a molecular weight of 512.52 g/mol. Its IUPAC name is 7-[2-[(4R)-4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]spiro[2,3-dihydro-1H-naphthalene-4,5'-pyrrolidine]-2',4'-dione.
| Compound Name | 7-[2-[(4R)-4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]spiro[2,3-dihydro-1H-naphthalene-4,5'-pyrrolidine]-2',4'-dione |
|---|---|
| PubChem CID | 58042235 |
| Molecular Formula | C28H24N4O6 |
| Molecular Weight | 512.52 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | 7-[2-[(4R)-4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]spiro[2,3-dihydro-1H-naphthalene-4,5'-pyrrolidine]-2',4'-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@@]1(C#Cc3ccc4c(c3)CCCC43NC(=O)CC3=O)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C28H24N4O6/c1-38-19-6-5-18-14-32(24(35)20(18)12-19)15-27(25(36)29-26(37)31-27)10-8-16-4-7-21-17(11-16)3-2-9-28(21)22(33)13-23(34)30-28/h4-7,11-12H,2-3,9,13-15H2,1H3,(H,30,34)(H2,29,31,36,37)/t27-,28?/m1/s1 |
| InChIKey | BPYZBADYFPCNOA-QXPUDEPPSA-N |
| XLogP | 0.90 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.52 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|