C22H17Cl2F2NO3 — CID 58042382
(4-methylphenyl) 5-chloro-4-[[5-chloro-6-(2-fluoropropan-2-yl)-3-pyridinyl]oxy]-2-fluorobenzoate (PubChem CID 58042382) has the molecular formula C22H17Cl2F2NO3 and a molecular weight of 452.28 g/mol. Its IUPAC name is (4-methylphenyl) 5-chloro-4-[[5-chloro-6-(2-fluoropropan-2-yl)-3-pyridinyl]oxy]-2-fluorobenzoate.
| Compound Name | (4-methylphenyl) 5-chloro-4-[[5-chloro-6-(2-fluoropropan-2-yl)-3-pyridinyl]oxy]-2-fluorobenzoate |
|---|---|
| PubChem CID | 58042382 |
| Molecular Formula | C22H17Cl2F2NO3 |
| Molecular Weight | 452.28 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | (4-methylphenyl) 5-chloro-4-[[5-chloro-6-(2-fluoropropan-2-yl)-3-pyridinyl]oxy]-2-fluorobenzoate |
| SMILES | Cc1ccc(OC(=O)c2cc(Cl)c(Oc3cnc(C(C)(C)F)c(Cl)c3)cc2F)cc1 |
| InChI | InChI=1S/C22H17Cl2F2NO3/c1-12-4-6-13(7-5-12)30-21(28)15-9-16(23)19(10-18(15)25)29-14-8-17(24)20(27-11-14)22(2,3)26/h4-11H,1-3H3 |
| InChIKey | MEKUJVMEWFZSAI-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.28 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|