C34H33N7O3 — CID 58056425
benzyl 7-(5-methyl-4-oxo-3-phenylquinazolin-2-yl)-7-(7H-purin-6-ylamino)heptanoate (PubChem CID 58056425) has the molecular formula C34H33N7O3 and a molecular weight of 587.68 g/mol. Its IUPAC name is benzyl 7-(5-methyl-4-oxo-3-phenylquinazolin-2-yl)-7-(7H-purin-6-ylamino)heptanoate.
| Compound Name | benzyl 7-(5-methyl-4-oxo-3-phenylquinazolin-2-yl)-7-(7H-purin-6-ylamino)heptanoate |
|---|---|
| PubChem CID | 58056425 |
| Molecular Formula | C34H33N7O3 |
| Molecular Weight | 587.68 g/mol |
| Exact Mass | 587.26 |
| IUPAC Name | benzyl 7-(5-methyl-4-oxo-3-phenylquinazolin-2-yl)-7-(7H-purin-6-ylamino)heptanoate |
| SMILES | Cc1cccc2nc(C(CCCCCC(=O)OCc3ccccc3)Nc3ncnc4nc[nH]c34)n(-c3ccccc3)c(=O)c12 |
| InChI | InChI=1S/C34H33N7O3/c1-23-12-11-18-26-29(23)34(43)41(25-15-7-3-8-16-25)33(40-26)27(39-32-30-31(36-21-35-30)37-22-38-32)17-9-4-10-19-28(42)44-20-24-13-5-2-6-14-24/h2-3,5-8,11-16,18,21-22,27H,4,9-10,17,19-20H2,1H3,(H2,35,36,37,38,39) |
| InChIKey | CNJHMOOEBCAQLH-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 127.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.68 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|