About 2-[3-(2-fluoroethylsulfanyl)-4-pyridinyl]-1,5-dimethylbenzimidazole
2-[3-(2-fluoroethylsulfanyl)-4-pyridinyl]-1,5-dimethylbenzimidazole (PubChem CID 58056769) has the molecular formula C16H16FN3S
and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-[3-(2-fluoroethylsulfanyl)-4-pyridinyl]-1,5-dimethylbenzimidazole.
Molecular Properties
| Compound Name | 2-[3-(2-fluoroethylsulfanyl)-4-pyridinyl]-1,5-dimethylbenzimidazole |
| PubChem CID | 58056769 |
| Molecular Formula | C16H16FN3S |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 2-[3-(2-fluoroethylsulfanyl)-4-pyridinyl]-1,5-dimethylbenzimidazole |
| SMILES | Cc1ccc2c(c1)nc(-c1ccncc1SCCF)n2C |
| InChI | InChI=1S/C16H16FN3S/c1-11-3-4-14-13(9-11)19-16(20(14)2)12-5-7-18-10-15(12)21-8-6-17/h3-5,7,9-10H,6,8H2,1-2H3 |
| InChIKey | NTMSEPLYPRYFBO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-(2-fluoroethylsulfanyl)-4-pyridinyl]-1,5-dimethylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2-fluoroethylsulfanyl)-4-pyridinyl]-1,5-dimethylbenzimidazole?
The IUPAC name of 2-[3-(2-fluoroethylsulfanyl)-4-pyridinyl]-1,5-dimethylbenzimidazole (CID 58056769) is 2-[3-(2-fluoroethylsulfanyl)-4-pyridinyl]-1,5-dimethylbenzimidazole.
What is the SMILES notation for 2-[3-(2-fluoroethylsulfanyl)-4-pyridinyl]-1,5-dimethylbenzimidazole?
The canonical SMILES for 2-[3-(2-fluoroethylsulfanyl)-4-pyridinyl]-1,5-dimethylbenzimidazole is Cc1ccc2c(c1)nc(-c1ccncc1SCCF)n2C.
What is the InChIKey of 2-[3-(2-fluoroethylsulfanyl)-4-pyridinyl]-1,5-dimethylbenzimidazole?
The InChIKey is NTMSEPLYPRYFBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16FN3S/c1-11-3-4-14-13(9-11)19-16(20(14)2)12-5-7-18-10-15(12)21-8-6-17/h3-5,7,9-10H,6,8H2,1-2H3.
What are the key properties of 2-[3-(2-fluoroethylsulfanyl)-4-pyridinyl]-1,5-dimethylbenzimidazole?
2-[3-(2-fluoroethylsulfanyl)-4-pyridinyl]-1,5-dimethylbenzimidazole has a molecular weight of 301.39 g/mol, XLogP of 4.01, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2-fluoroethylsulfanyl)-4-pyridinyl]-1,5-dimethylbenzimidazole is sourced from PubChem (CID 58056769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).