C49H84N2O2 — CID 58069767
2-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]-N-ethyl-N-(pyridin-4-ylmethyl)ethanamine (PubChem CID 58069767) has the molecular formula C49H84N2O2 and a molecular weight of 733.22 g/mol. Its IUPAC name is 2-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]-N-ethyl-N-(pyridin-4-ylmethyl)ethanamine.
| Compound Name | 2-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]-N-ethyl-N-(pyridin-4-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 58069767 |
| Molecular Formula | C49H84N2O2 |
| Molecular Weight | 733.22 g/mol |
| Exact Mass | 732.65 |
| IUPAC Name | 2-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]-N-ethyl-N-(pyridin-4-ylmethyl)ethanamine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)OCC(CCN(CC)Cc2ccncc2)O1 |
| InChI | InChI=1S/C49H84N2O2/c1-4-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-40-49(41-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-5-2)52-46-48(53-49)39-44-51(6-3)45-47-37-42-50-43-38-47/h13-16,19-22,37-38,42-43,48H,4-12,17-18,23-36,39-41,44-46H2,1-3H3/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | SYAXHMYIRFOETJ-KWXKLSQISA-N |
| XLogP | 14.81 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.22 |
| LogP ≤ 5 | 14.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|