C32H52N6O3 — CID 58071118
(2S,5R)-N-[(4S)-8-amino-7-(1H-indol-3-ylmethyl)-2-methyl-5,8-dioxooctan-4-yl]-8-(diaminomethylideneamino)-5-methyl-2-(2-methylpropyl)octanamide (PubChem CID 58071118) has the molecular formula C32H52N6O3 and a molecular weight of 568.81 g/mol. Its IUPAC name is (2S,5R)-N-[(4S)-8-amino-7-(1H-indol-3-ylmethyl)-2-methyl-5,8-dioxooctan-4-yl]-8-(diaminomethylideneamino)-5-methyl-2-(2-methylpropyl)octanamide.
| Compound Name | (2S,5R)-N-[(4S)-8-amino-7-(1H-indol-3-ylmethyl)-2-methyl-5,8-dioxooctan-4-yl]-8-(diaminomethylideneamino)-5-methyl-2-(2-methylpropyl)octanamide |
|---|---|
| PubChem CID | 58071118 |
| Molecular Formula | C32H52N6O3 |
| Molecular Weight | 568.81 g/mol |
| Exact Mass | 568.41 |
| IUPAC Name | (2S,5R)-N-[(4S)-8-amino-7-(1H-indol-3-ylmethyl)-2-methyl-5,8-dioxooctan-4-yl]-8-(diaminomethylideneamino)-5-methyl-2-(2-methylpropyl)octanamide |
| SMILES | CC(C)C[C@H](CC[C@@H](C)CCCN=C(N)N)C(=O)N[C@@H](CC(C)C)C(=O)CC(Cc1c[nH]c2ccccc12)C(N)=O |
| InChI | InChI=1S/C32H52N6O3/c1-20(2)15-23(13-12-22(5)9-8-14-36-32(34)35)31(41)38-28(16-21(3)4)29(39)18-24(30(33)40)17-25-19-37-27-11-7-6-10-26(25)27/h6-7,10-11,19-24,28,37H,8-9,12-18H2,1-5H3,(H2,33,40)(H,38,41)(H4,34,35,36)/t22-,23-,24?,28-/m0/s1 |
| InChIKey | GCUJGDWWFWNUQC-NIKPOWFPSA-N |
| XLogP | 4.43 |
| TPSA | 169.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.81 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|