C19H16N4O — CID 58076714
2-(3-isocyanophenyl)-5-(4-methyl-2-pyridinyl)-6,7-dihydro-4H-[1,3]oxazolo[5,4-c]pyridine (PubChem CID 58076714) has the molecular formula C19H16N4O and a molecular weight of 316.36 g/mol. Its IUPAC name is 2-(3-isocyanophenyl)-5-(4-methyl-2-pyridinyl)-6,7-dihydro-4H-[1,3]oxazolo[5,4-c]pyridine.
| Compound Name | 2-(3-isocyanophenyl)-5-(4-methyl-2-pyridinyl)-6,7-dihydro-4H-[1,3]oxazolo[5,4-c]pyridine |
|---|---|
| PubChem CID | 58076714 |
| Molecular Formula | C19H16N4O |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 2-(3-isocyanophenyl)-5-(4-methyl-2-pyridinyl)-6,7-dihydro-4H-[1,3]oxazolo[5,4-c]pyridine |
| SMILES | [C-]#[N+]c1cccc(-c2nc3c(o2)CN(c2cc(C)ccn2)CC3)c1 |
| InChI | InChI=1S/C19H16N4O/c1-13-6-8-21-18(10-13)23-9-7-16-17(12-23)24-19(22-16)14-4-3-5-15(11-14)20-2/h3-6,8,10-11H,7,9,12H2,1H3 |
| InChIKey | JGOWWSMJNWCEIH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 46.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|