C23H25N3OS — CID 58078521
1-[(3R,4R)-3-(3,8-diazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)-4-methylpiperidin-1-yl]-3-thiophen-2-ylpropan-1-one (PubChem CID 58078521) has the molecular formula C23H25N3OS and a molecular weight of 391.54 g/mol. Its IUPAC name is 1-[(3R,4R)-3-(3,8-diazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)-4-methylpiperidin-1-yl]-3-thiophen-2-ylpropan-1-one.
| Compound Name | 1-[(3R,4R)-3-(3,8-diazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)-4-methylpiperidin-1-yl]-3-thiophen-2-ylpropan-1-one |
|---|---|
| PubChem CID | 58078521 |
| Molecular Formula | C23H25N3OS |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 1-[(3R,4R)-3-(3,8-diazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)-4-methylpiperidin-1-yl]-3-thiophen-2-ylpropan-1-one |
| SMILES | C[C@@H]1CCN(C(=O)CCc2cccs2)C[C@@H]1n1ccc2cnc3c(c21)C=CC3 |
| InChI | InChI=1S/C23H25N3OS/c1-16-9-11-25(22(27)8-7-18-4-3-13-28-18)15-21(16)26-12-10-17-14-24-20-6-2-5-19(20)23(17)26/h2-5,10,12-14,16,21H,6-9,11,15H2,1H3/t16-,21+/m1/s1 |
| InChIKey | OQAWEAQKVUDGHW-IERDGZPVSA-N |
| XLogP | 4.71 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |