C16H21N5O3 — CID 58081341
tert-butyl N-[6-methyl-5-[(1H-pyrazole-4-carbonylamino)methyl]-2-pyridinyl]carbamate (PubChem CID 58081341) has the molecular formula C16H21N5O3 and a molecular weight of 331.38 g/mol. Its IUPAC name is tert-butyl N-[6-methyl-5-[(1H-pyrazole-4-carbonylamino)methyl]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[6-methyl-5-[(1H-pyrazole-4-carbonylamino)methyl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 58081341 |
| Molecular Formula | C16H21N5O3 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | tert-butyl N-[6-methyl-5-[(1H-pyrazole-4-carbonylamino)methyl]-2-pyridinyl]carbamate |
| SMILES | Cc1nc(NC(=O)OC(C)(C)C)ccc1CNC(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C16H21N5O3/c1-10-11(7-17-14(22)12-8-18-19-9-12)5-6-13(20-10)21-15(23)24-16(2,3)4/h5-6,8-9H,7H2,1-4H3,(H,17,22)(H,18,19)(H,20,21,23) |
| InChIKey | MHTURIWBXJJVIE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |