C15H16FN3 — CID 58095817
6-(2-fluoro-4-pyridinyl)-1,2-dimethyl-3,4-dihydrocinnoline (PubChem CID 58095817) has the molecular formula C15H16FN3 and a molecular weight of 257.31 g/mol. Its IUPAC name is 6-(2-fluoro-4-pyridinyl)-1,2-dimethyl-3,4-dihydrocinnoline.
| Compound Name | 6-(2-fluoro-4-pyridinyl)-1,2-dimethyl-3,4-dihydrocinnoline |
|---|---|
| PubChem CID | 58095817 |
| Molecular Formula | C15H16FN3 |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 6-(2-fluoro-4-pyridinyl)-1,2-dimethyl-3,4-dihydrocinnoline |
| SMILES | CN1CCc2cc(-c3ccnc(F)c3)ccc2N1C |
| InChI | InChI=1S/C15H16FN3/c1-18-8-6-13-9-11(3-4-14(13)19(18)2)12-5-7-17-15(16)10-12/h3-5,7,9-10H,6,8H2,1-2H3 |
| InChIKey | OABLVEHZNLYPSR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|